 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | OC(=O)C(NC(=O)CNC(=O)CC(=O)C)Cc1c2c([nH]c1)cccc2 |
| InChI: | InChI=1/C17H19N3O5/c1-10(21)6-15(22)19-9-16(23)20-14(17(24)25)7-11-8-18-13-5-3-2-4-12(11)13/h2-5,8,14,18H,6-7,9H2,1H3,(H,19,22)(H,20,23)(H,24,25)/t14-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=66.3441 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 345.355 g/mol | logS: -2.27142 | SlogP: 0.37507 | Reactive groups: 1 | |||
| Topological Properties | ||||||
| Globularity: 0.0931979 | Sterimol/B1: 3.66813 | Sterimol/B2: 4.29564 | Sterimol/B3: 4.91792 | |||
| Sterimol/B4: 7.49049 | Sterimol/L: 16.9512 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 604.014 | Positive charged surface: 372.266 | Negative charged surface: 228.439 | Volume: 316.125 | |||
| Hydrophobic surface: 361.748 | Hydrophilic surface: 242.266 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 5 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
