 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C1N=C(Nc2c1cccc2)CN(C(=O)Nc1ccc(cc1)C)C1CCCC1 |
| InChI: | InChI=1/C22H24N4O2/c1-15-10-12-16(13-11-15)23-22(28)26(17-6-2-3-7-17)14-20-24-19-9-5-4-8-18(19)21(27)25-20/h4-5,8-13,17H,2-3,6-7,14H2,1H3,(H,23,28)(H,24,25,27) |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=96.984 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 376.46 g/mol | logS: -5.35295 | SlogP: 4.43592 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0908663 | Sterimol/B1: 2.99393 | Sterimol/B2: 3.69654 | Sterimol/B3: 4.36111 | |||
| Sterimol/B4: 9.01432 | Sterimol/L: 17.8239 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 652.025 | Positive charged surface: 409.354 | Negative charged surface: 242.671 | Volume: 365.875 | |||
| Hydrophobic surface: 558.424 | Hydrophilic surface: 93.601 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 0 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.