 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | Clc1ccc(cc1)CSCC1OC(n2c3ncnc(N)c3nc2)C([O-])C1O |
| InChI: | InChI=1/C17H17ClN5O3S/c18-10-3-1-9(2-4-10)5-27-6-11-13(24)14(25)17(26-11)23-8-22-12-15(19)20-7-21-16(12)23/h1-4,7-8,11,13-14,17,24H,5-6H2,(H2,19,20,21)/q-1/t11-,13-,14-,17+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=72.3429 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 406.874 g/mol | logS: -4.73081 | SlogP: 2.4146 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0633929 | Sterimol/B1: 3.28745 | Sterimol/B2: 3.51008 | Sterimol/B3: 4.23635 | |||
| Sterimol/B4: 6.6674 | Sterimol/L: 19.7278 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 640.529 | Positive charged surface: 369.836 | Negative charged surface: 270.694 | Volume: 345.75 | |||
| Hydrophobic surface: 381.698 | Hydrophilic surface: 258.831 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 5 | Acid groups: 1 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
