 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | OC1CCCCC1NC(=O)Nc1cc(NC(=O)NC2CCCCC2O)ccc1C |
| InChI: | InChI=1/C21H32N4O4/c1-13-10-11-14(22-20(28)23-15-6-2-4-8-18(15)26)12-17(13)25-21(29)24-16-7-3-5-9-19(16)27/h10-12,15-16,18-19,26-27H,2-9H2,1H3,(H2,22,23,28)(H2,24,25,29)/t15-,16+,18+,19-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=48.8366 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 404.511 g/mol | logS: -3.13873 | SlogP: 2.84502 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0441005 | Sterimol/B1: 2.37594 | Sterimol/B2: 3.76812 | Sterimol/B3: 4.04829 | |||
| Sterimol/B4: 8.61168 | Sterimol/L: 20.7589 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 714.197 | Positive charged surface: 524.766 | Negative charged surface: 189.431 | Volume: 392 | |||
| Hydrophobic surface: 538.988 | Hydrophilic surface: 175.209 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 6 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.