Type: Neutral
Formula: C17H16ClN3O7
SMILES: |
Clc1ccc(cc1)C=1NC(=O)N(C(=O)C=1C#N)C1OC(CO)C(O)C(O)C1O |
InChI: |
InChI=1/C17H16ClN3O7/c18-8-3-1-7(2-4-8)11-9(5-19)15(26)21(17(27)20-11)16-14(25)13(24)12(23)10(6-22)28-16/h1-4,10,12-14,16,22-25H,6H2,(H,20,27)/t10-,12+,13+,14-,16+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 409.782 g/mol | logS: -2.85706 | SlogP: -1.07362 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.128794 | Sterimol/B1: 3.22769 | Sterimol/B2: 4.89129 | Sterimol/B3: 4.97981 |
Sterimol/B4: 5.81682 | Sterimol/L: 16.3965 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 589.702 | Positive charged surface: 342.051 | Negative charged surface: 247.651 | Volume: 327.375 |
Hydrophobic surface: 306.473 | Hydrophilic surface: 283.229 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 8 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |