 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | Oc1ccccc1\C=N\c1cc(ccc1)C(O)C(NC(=O)Cc1ccccc1)C(=O)[O-] |
| InChI: | InChI=1/C24H22N2O5/c27-20-12-5-4-9-18(20)15-25-19-11-6-10-17(14-19)23(29)22(24(30)31)26-21(28)13-16-7-2-1-3-8-16/h1-12,14-15,22-23,27,29H,13H2,(H,26,28)(H,30,31)/p-1/b25-15+/t22-,23+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=75.193 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 417.441 g/mol | logS: -4.97692 | SlogP: 1.74907 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.122592 | Sterimol/B1: 2.68178 | Sterimol/B2: 4.70736 | Sterimol/B3: 5.54858 | |||
| Sterimol/B4: 9.5635 | Sterimol/L: 17.0423 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 687.698 | Positive charged surface: 369.562 | Negative charged surface: 318.136 | Volume: 395.125 | |||
| Hydrophobic surface: 531.235 | Hydrophilic surface: 156.463 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 4 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
