Type: Neutral
Formula: C12H16ClN5O2S
SMILES: |
ClC1C(SCC)C(OC1CO)n1c2ncnc(N)c2nc1 |
InChI: |
InChI=1/C12H16ClN5O2S/c1-2-21-9-7(13)6(3-19)20-12(9)18-5-17-8-10(14)15-4-16-11(8)18/h4-7,9,12,19H,2-3H2,1H3,(H2,14,15,16)/t6-,7-,9+,12-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 329.812 g/mol | logS: -3.45213 | SlogP: 1.5427 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.183024 | Sterimol/B1: 2.43591 | Sterimol/B2: 2.77346 | Sterimol/B3: 5.29131 |
Sterimol/B4: 8.93787 | Sterimol/L: 13.7554 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 534.765 | Positive charged surface: 372.119 | Negative charged surface: 162.646 | Volume: 280.625 |
Hydrophobic surface: 230.412 | Hydrophilic surface: 304.353 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |