 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1C(CCC(=O)NCCc2c3c([nH]c2)cccc3)C(O)C([O-])C1n1c2ncnc(N)c2n c1 |
| InChI: | InChI=1/C22H24N7O4/c23-20-17-21(27-10-26-20)29(11-28-17)22-19(32)18(31)15(33-22)5-6-16(30)24-8-7-12-9-25-14-4-2-1-3-13(12)14/h1-4,9-11,15,18-19,22,25,31H,5-8H2,(H,24,30)(H2,23,26,27)/q-1/t15-,18-,19+,22-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=65.6092 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 450.479 g/mol | logS: -3.61227 | SlogP: 1.18177 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0473885 | Sterimol/B1: 2.38385 | Sterimol/B2: 4.70764 | Sterimol/B3: 5.92811 | |||
| Sterimol/B4: 7.28647 | Sterimol/L: 21.476 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 740.836 | Positive charged surface: 509.532 | Negative charged surface: 227.211 | Volume: 410.625 | |||
| Hydrophobic surface: 413.268 | Hydrophilic surface: 327.568 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 4 | Hydrogen bond acceptors: 6 | Acid groups: 1 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
