 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2NC(=O)C(NCO)c1ccccc1 |
| InChI: | InChI=1/C17H21N3O5S/c1-17(2)12(16(24)25)20-14(23)11(15(20)26-17)19-13(22)10(18-8-21)9-6-4-3-5-7-9/h3-7,10-12,15,18,21H,8H2,1-2H3,(H,19,22)(H,24,25)/t10-,11-,12-,15+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=133.295 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 379.437 g/mol | logS: -2.68804 | SlogP: -0.0057 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0835918 | Sterimol/B1: 2.38125 | Sterimol/B2: 4.78919 | Sterimol/B3: 5.28993 | |||
| Sterimol/B4: 6.33295 | Sterimol/L: 14.6818 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 619.684 | Positive charged surface: 340.401 | Negative charged surface: 255.544 | Volume: 335.25 | |||
| Hydrophobic surface: 324.797 | Hydrophilic surface: 294.887 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 5 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
