 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1C(CO)C(O)C(O)C1n1c2NC(=NC(=O)c2cc1)N |
| InChI: | InChI=1/C11H14N4O5/c12-11-13-8-4(9(19)14-11)1-2-15(8)10-7(18)6(17)5(3-16)20-10/h1-2,5-7,10,16-18H,3H2,(H3,12,13,14,19)/t5-,6-,7-,10-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=60.6216 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 282.256 g/mol | logS: -0.35174 | SlogP: -1.9245 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0653842 | Sterimol/B1: 2.51274 | Sterimol/B2: 2.8669 | Sterimol/B3: 3.37794 | |||
| Sterimol/B4: 6.99718 | Sterimol/L: 13.3702 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 476.548 | Positive charged surface: 317.528 | Negative charged surface: 159.019 | Volume: 236 | |||
| Hydrophobic surface: 159.231 | Hydrophilic surface: 317.317 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 5 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
