 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C1Nc2c(cccc2)C12C1C(=CCN(C1)CC)C(C#N)(C#N)C(=N)C2C#N |
| InChI: | InChI=1/C21H18N6O/c1-2-27-8-7-13-16(10-27)21(14-5-3-4-6-17(14)26-19(21)28)15(9-22)18(25)20(13,11-23)12-24/h3-7,15-16,25H,2,8,10H2,1H3,(H,26,28)/b25-18-/t15-,16+,21-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=97.9395 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 370.416 g/mol | logS: -3.36637 | SlogP: 1.96132 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.231851 | Sterimol/B1: 2.5447 | Sterimol/B2: 4.61091 | Sterimol/B3: 4.70557 | |||
| Sterimol/B4: 9.00506 | Sterimol/L: 12.2407 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 566.362 | Positive charged surface: 303.471 | Negative charged surface: 262.891 | Volume: 343.875 | |||
| Hydrophobic surface: 280.82 | Hydrophilic surface: 285.542 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
