Type: Neutral
Formula: C16H21N3O3
SMILES: |
OC(=O)C(NC(=O)C(N)C(C)C)Cc1c2c([nH]c1)cccc2 |
InChI: |
InChI=1/C16H21N3O3/c1-9(2)14(17)15(20)19-13(16(21)22)7-10-8-18-12-6-4-3-5-11(10)12/h3-6,8-9,13-14,18H,7,17H2,1-2H3,(H,19,20)(H,21,22)/t13-,14-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 303.362 g/mol | logS: -2.30033 | SlogP: 1.26307 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.132599 | Sterimol/B1: 3.10482 | Sterimol/B2: 3.96359 | Sterimol/B3: 3.97309 |
Sterimol/B4: 7.58163 | Sterimol/L: 14.9976 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 540.88 | Positive charged surface: 337.925 | Negative charged surface: 199.414 | Volume: 293.375 |
Hydrophobic surface: 309.989 | Hydrophilic surface: 230.891 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |