Type: Neutral
Formula: C17H19N3O6
SMILES: |
O1C(C2OC(OC2C1N1C=CC(=NC1=O)N)c1ccc(OC)cc1)CO |
InChI: |
InChI=1/C17H19N3O6/c1-23-10-4-2-9(3-5-10)16-25-13-11(8-21)24-15(14(13)26-16)20-7-6-12(18)19-17(20)22/h2-7,11,13-16,21H,8H2,1H3,(H2,18,19,22)/t11-,13+,14+,15-,16-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 361.354 g/mol | logS: -2.61062 | SlogP: 0.597 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.130053 | Sterimol/B1: 4.11656 | Sterimol/B2: 4.27933 | Sterimol/B3: 5.54908 |
Sterimol/B4: 6.74405 | Sterimol/L: 14.1769 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 582.828 | Positive charged surface: 402.561 | Negative charged surface: 180.268 | Volume: 318.125 |
Hydrophobic surface: 369.781 | Hydrophilic surface: 213.047 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
![](img/zinc.png) |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |