Type: Neutral
Formula: C18H27N3O2
SMILES: |
O1N(C)C(CN(C(=O)NC2CCCCC2)C1c1ccccc1)C |
InChI: |
InChI=1/C18H27N3O2/c1-14-13-21(18(22)19-16-11-7-4-8-12-16)17(23-20(14)2)15-9-5-3-6-10-15/h3,5-6,9-10,14,16-17H,4,7-8,11-13H2,1-2H3,(H,19,22)/t14-,17-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 317.433 g/mol | logS: -3.00967 | SlogP: 3.3905 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.121052 | Sterimol/B1: 2.24034 | Sterimol/B2: 3.45559 | Sterimol/B3: 4.32386 |
Sterimol/B4: 10.2595 | Sterimol/L: 15.0232 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 584.209 | Positive charged surface: 448.715 | Negative charged surface: 135.494 | Volume: 324.5 |
Hydrophobic surface: 548.387 | Hydrophilic surface: 35.822 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |