 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S1C2N(C(=O)C2NC(=O)C(O)c2ccccc2)C(C(=O)[O-])=C(C1)COC(=O)C |
| InChI: | InChI=1/C18H18N2O7S/c1-9(21)27-7-11-8-28-17-12(16(24)20(17)13(11)18(25)26)19-15(23)14(22)10-5-3-2-4-6-10/h2-6,12,14,17,22H,7-8H2,1H3,(H,19,23)(H,25,26)/p-1/t12-,14-,17+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=78.8639 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 405.407 g/mol | logS: -3.81812 | SlogP: -1.2175 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0647462 | Sterimol/B1: 2.29555 | Sterimol/B2: 4.19128 | Sterimol/B3: 5.49036 | |||
| Sterimol/B4: 5.73883 | Sterimol/L: 18.0454 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 653.031 | Positive charged surface: 300.001 | Negative charged surface: 326.704 | Volume: 347 | |||
| Hydrophobic surface: 359.473 | Hydrophilic surface: 293.558 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 4 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
