Type: Neutral
Formula: C16H21N5O3
SMILES: |
O=C1N(C)C(=Cn2c1ccc2)CCCN=C(NC(=O)C)NC(=O)C |
InChI: |
InChI=1/C16H21N5O3/c1-11(22)18-16(19-12(2)23)17-8-4-6-13-10-21-9-5-7-14(21)15(24)20(13)3/h5,7,9-10H,4,6,8H2,1-3H3,(H2,17,18,19,22,23) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 331.376 g/mol | logS: -1.38372 | SlogP: 0.7805 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0867933 | Sterimol/B1: 2.34921 | Sterimol/B2: 3.30851 | Sterimol/B3: 5.19835 |
Sterimol/B4: 7.7198 | Sterimol/L: 17.7793 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 609.37 | Positive charged surface: 377.538 | Negative charged surface: 231.832 | Volume: 315.625 |
Hydrophobic surface: 431.154 | Hydrophilic surface: 178.216 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |