 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C(NC1CCCN(C1)CC)c1ccc(Nc2c3c(ncc2)cc2c(c3)cccc2)cc1 |
| InChI: | InChI=1/C27H28N4O/c1-2-31-15-5-8-23(18-31)30-27(32)19-9-11-22(12-10-19)29-25-13-14-28-26-17-21-7-4-3-6-20(21)16-24(25)26/h3-4,6-7,9-14,16-17,23H,2,5,8,15,18H2,1H3,(H,28,29)(H,30,32)/t23-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=126.043 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 424.548 g/mol | logS: -6.39523 | SlogP: 5.3457 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0371335 | Sterimol/B1: 2.43406 | Sterimol/B2: 3.97958 | Sterimol/B3: 5.49376 | |||
| Sterimol/B4: 5.92811 | Sterimol/L: 23.5658 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 743.083 | Positive charged surface: 486.744 | Negative charged surface: 239.844 | Volume: 427 | |||
| Hydrophobic surface: 650.783 | Hydrophilic surface: 92.3 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
Ions/Tautomers related molecules
