Type: Neutral
Formula: C8H14FNO6
SMILES: |
FCC(=O)NC(C(O)C(O)C(O)CO)C=O |
InChI: |
InChI=1/C8H14FNO6/c9-1-6(14)10-4(2-11)7(15)8(16)5(13)3-12/h2,4-5,7-8,12-13,15-16H,1,3H2,(H,10,14)/t4-,5+,7+,8-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 239.199 g/mol | logS: 0.69081 | SlogP: -3.2854 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.128048 | Sterimol/B1: 3.10808 | Sterimol/B2: 3.26162 | Sterimol/B3: 3.56433 |
Sterimol/B4: 5.88197 | Sterimol/L: 12.4709 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 423.912 | Positive charged surface: 269.297 | Negative charged surface: 154.615 | Volume: 198.375 |
Hydrophobic surface: 133.841 | Hydrophilic surface: 290.071 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |