Type: Ionized
Formula: C8H13O8-
SMILES: |
O1C(O)(CC(=O)[O-])C(O)C(O)C(O)C1CO |
InChI: |
InChI=1/C8H14O8/c9-2-3-5(12)6(13)7(14)8(15,16-3)1-4(10)11/h3,5-7,9,12-15H,1-2H2,(H,10,11)/p-1/t3-,5-,6+,7+,8+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 237.184 g/mol | logS: 0.93651 | SlogP: -4.7112 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.205439 | Sterimol/B1: 2.66068 | Sterimol/B2: 2.92865 | Sterimol/B3: 3.78201 |
Sterimol/B4: 6.82276 | Sterimol/L: 11.1193 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 384.381 | Positive charged surface: 234.057 | Negative charged surface: 150.323 | Volume: 187.875 |
Hydrophobic surface: 128.548 | Hydrophilic surface: 255.833 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 6 | Acid groups: 2 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Parent related molecule:
|