Type: Neutral
Formula: C10H13N5O5
SMILES: |
O=C1NC(=Nc2ncc(nc12)C(O)C(O)C(O)CO)N |
InChI: |
InChI=1/C10H13N5O5/c11-10-14-8-5(9(20)15-10)13-3(1-12-8)6(18)7(19)4(17)2-16/h1,4,6-7,16-19H,2H2,(H3,11,12,14,15,20)/t4-,6-,7+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 283.244 g/mol | logS: 0.59712 | SlogP: -2.9908 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0449733 | Sterimol/B1: 2.42369 | Sterimol/B2: 3.16356 | Sterimol/B3: 3.3545 |
Sterimol/B4: 6.41967 | Sterimol/L: 15.5716 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 463.527 | Positive charged surface: 326.581 | Negative charged surface: 136.946 | Volume: 228.625 |
Hydrophobic surface: 116.036 | Hydrophilic surface: 347.491 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 6 | Hydrogen bond acceptors: 8 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |