Type: Neutral
Formula: C20H28N2O3
SMILES: |
Oc1ccccc1C(=O)NNC(CC(=O)C1C(CC=CC1C)(C)C)C |
InChI: |
InChI=1/C20H28N2O3/c1-13-8-7-11-20(3,4)18(13)17(24)12-14(2)21-22-19(25)15-9-5-6-10-16(15)23/h5-10,13-14,18,21,23H,11-12H2,1-4H3,(H,22,25)/t13-,14-,18-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 344.455 g/mol | logS: -3.64269 | SlogP: 3.2127 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.0976521 | Sterimol/B1: 3.39214 | Sterimol/B2: 3.68354 | Sterimol/B3: 4.48355 |
Sterimol/B4: 6.67786 | Sterimol/L: 17.0495 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 613.9 | Positive charged surface: 403.634 | Negative charged surface: 210.266 | Volume: 346.75 |
Hydrophobic surface: 429.583 | Hydrophilic surface: 184.317 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
![](img/zinc.png) |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |