 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O(C)c1cc2C3N(CCc2cc1OC)C(CC)C(O)(CC3)Cc1ncccc1 |
| InChI: | InChI=1/C23H30N2O3/c1-4-22-23(26,15-17-7-5-6-11-24-17)10-8-19-18-14-21(28-3)20(27-2)13-16(18)9-12-25(19)22/h5-7,11,13-14,19,22,26H,4,8-10,12,15H2,1-3H3/t19-,22+,23+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=163.037 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 382.504 g/mol | logS: -3.14393 | SlogP: 3.63964 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.103358 | Sterimol/B1: 2.07453 | Sterimol/B2: 2.31222 | Sterimol/B3: 5.78149 | |||
| Sterimol/B4: 9.68911 | Sterimol/L: 17.6476 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 638.611 | Positive charged surface: 486.534 | Negative charged surface: 152.077 | Volume: 380.625 | |||
| Hydrophobic surface: 573.188 | Hydrophilic surface: 65.423 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
