Type: Neutral
Formula: C21H23ClN2O2S
SMILES: |
Clc1cc(N(C(=O)c2sc3CCCc3c2)CC(=O)NC2CCCC2)ccc1 |
InChI: |
InChI=1/C21H23ClN2O2S/c22-15-6-4-9-17(12-15)24(13-20(25)23-16-7-1-2-8-16)21(26)19-11-14-5-3-10-18(14)27-19/h4,6,9,11-12,16H,1-3,5,7-8,10,13H2,(H,23,25) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 402.946 g/mol | logS: -5.49192 | SlogP: 4.59574 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.102472 | Sterimol/B1: 2.48393 | Sterimol/B2: 5.72912 | Sterimol/B3: 6.07478 |
Sterimol/B4: 6.97742 | Sterimol/L: 15.5211 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 633.246 | Positive charged surface: 393.308 | Negative charged surface: 239.938 | Volume: 370.625 |
Hydrophobic surface: 573.46 | Hydrophilic surface: 59.786 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |