Type: Neutral
Formula: C16H27NO6
SMILES: |
O1C2C(OC1(C)C)C1OC(OC1OC2C(=O)NCCCC)(C)C |
InChI: |
InChI=1/C16H27NO6/c1-6-7-8-17-13(18)11-9-10(21-15(2,3)20-9)12-14(19-11)23-16(4,5)22-12/h9-12,14H,6-8H2,1-5H3,(H,17,18)/t9-,10-,11+,12+,14-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 329.393 g/mol | logS: -3.26852 | SlogP: 1.2992 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.111456 | Sterimol/B1: 3.24406 | Sterimol/B2: 3.54521 | Sterimol/B3: 5.14203 |
Sterimol/B4: 7.32131 | Sterimol/L: 16.159 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 571.457 | Positive charged surface: 397.572 | Negative charged surface: 173.885 | Volume: 315 |
Hydrophobic surface: 377.838 | Hydrophilic surface: 193.619 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |