Type: Neutral
Formula: C12H12BrN5O4
SMILES: |
Brc1n(c2ncnc(N)c2c1C#N)C1OC(CO)C(O)C1O |
InChI: |
InChI=1/C12H12BrN5O4/c13-9-4(1-14)6-10(15)16-3-17-11(6)18(9)12-8(21)7(20)5(2-19)22-12/h3,5,7-8,12,19-21H,2H2,(H2,15,16,17)/t5-,7+,8+,12-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 370.163 g/mol | logS: -3.05802 | SlogP: -0.645316 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.118106 | Sterimol/B1: 2.52309 | Sterimol/B2: 3.60367 | Sterimol/B3: 4.76155 |
Sterimol/B4: 8.11605 | Sterimol/L: 13.8385 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 493.598 | Positive charged surface: 317.462 | Negative charged surface: 170.293 | Volume: 271.75 |
Hydrophobic surface: 189.825 | Hydrophilic surface: 303.773 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |