Type: Neutral
Formula: C12H14BrN5O5
SMILES: |
Brc1n(c2ncnc(N)c2c1C(=O)N)C1OC(CO)C(O)C1O |
InChI: |
InChI=1/C12H14BrN5O5/c13-8-4(10(15)22)5-9(14)16-2-17-11(5)18(8)12-7(21)6(20)3(1-19)23-12/h2-3,6-7,12,19-21H,1H2,(H2,15,22)(H2,14,16,17)/t3-,6+,7-,12+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 388.178 g/mol | logS: -2.95921 | SlogP: -1.4181 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0860289 | Sterimol/B1: 2.36318 | Sterimol/B2: 3.3431 | Sterimol/B3: 3.37676 |
Sterimol/B4: 8.37797 | Sterimol/L: 12.8553 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 504.576 | Positive charged surface: 326.888 | Negative charged surface: 172.554 | Volume: 282.625 |
Hydrophobic surface: 184.701 | Hydrophilic surface: 319.875 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |