Type: Ionized
Formula: C12H16NO3-
| SMILES: |
O=C(NCCC)C1C2CC(C=C2)C1C(=O)[O-] |
| InChI: |
InChI=1/C12H17NO3/c1-2-5-13-11(14)9-7-3-4-8(6-7)10(9)12(15)16/h3-4,7-10H,2,5-6H2,1H3,(H,13,14)(H,15,16)/p-1/t7-,8+,9-,10+/m1/s1 |
MOE's Descriptors
| Physical Properties | | | |
| Molecular Weight: 222.264 g/mol | logS: -0.89302 | SlogP: -0.2992 | Reactive groups: 0 |
| | | | |
| Topological Properties | | | |
| Globularity: 0.105403 | Sterimol/B1: 3.46564 | Sterimol/B2: 3.81796 | Sterimol/B3: 3.88917 |
| Sterimol/B4: 4.78865 | Sterimol/L: 13.2266 | | | |
| | | | |
| Surface and Volume Properties | | | |
| Accessible surface: 428.266 | Positive charged surface: 296.02 | Negative charged surface: 132.246 | Volume: 214.75 |
| Hydrophobic surface: 288.964 | Hydrophilic surface: 139.302 | | |
| | | | |
| Pharmacophoric Properties | | | |
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 1 | Acid groups: 2 | Basic groups: 0 |
| Chiral centers: 4 | | | |
| | | | |
| Drug- and Lead-like Properties | | | |
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
| |
search links for this molecule: |
|
 |
|
|
Parent related molecule:
|
