Type: Neutral
Formula: C12H16N2O4
SMILES: |
Oc1ccc(cc1)CC(N)C(=O)NC(C(O)=O)C |
InChI: |
InChI=1/C12H16N2O4/c1-7(12(17)18)14-11(16)10(13)6-8-2-4-9(15)5-3-8/h2-5,7,10,15H,6,13H2,1H3,(H,14,16)(H,17,18)/t7-,10+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 252.27 g/mol | logS: -1.24494 | SlogP: -0.14873 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0650352 | Sterimol/B1: 2.0283 | Sterimol/B2: 3.67978 | Sterimol/B3: 4.47095 |
Sterimol/B4: 4.87116 | Sterimol/L: 15.5135 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 483.027 | Positive charged surface: 301.245 | Negative charged surface: 181.783 | Volume: 236.125 |
Hydrophobic surface: 238.606 | Hydrophilic surface: 244.421 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |