Type: Neutral
Formula: C14H20N2O3
SMILES: |
OC(=O)C(NC(=O)C(N)CCC)Cc1ccccc1 |
InChI: |
InChI=1/C14H20N2O3/c1-2-6-11(15)13(17)16-12(14(18)19)9-10-7-4-3-5-8-10/h3-5,7-8,11-12H,2,6,9,15H2,1H3,(H,16,17)(H,18,19)/t11-,12-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 264.325 g/mol | logS: -2.32388 | SlogP: 0.92587 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.124329 | Sterimol/B1: 2.40261 | Sterimol/B2: 4.58617 | Sterimol/B3: 5.02421 |
Sterimol/B4: 6.57793 | Sterimol/L: 14.3925 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 518.968 | Positive charged surface: 334.444 | Negative charged surface: 184.524 | Volume: 262.125 |
Hydrophobic surface: 334.439 | Hydrophilic surface: 184.529 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |