 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O(Cc1ccccc1)C(=O)NN(CC(=O)NC(Cc1c2c([nH]c1)cccc2)C(=O)N)C |
| InChI: | InChI=1/C22H25N5O4/c1-27(26-22(30)31-14-15-7-3-2-4-8-15)13-20(28)25-19(21(23)29)11-16-12-24-18-10-6-5-9-17(16)18/h2-10,12,19,24H,11,13-14H2,1H3,(H2,23,29)(H,25,28)(H,26,30)/t19-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=103.942 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 423.473 g/mol | logS: -3.9511 | SlogP: 1.72007 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.284738 | Sterimol/B1: 2.35316 | Sterimol/B2: 2.56999 | Sterimol/B3: 8.31505 | |||
| Sterimol/B4: 9.65631 | Sterimol/L: 13.1984 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 727.242 | Positive charged surface: 467.608 | Negative charged surface: 255.842 | Volume: 402.25 | |||
| Hydrophobic surface: 522.357 | Hydrophilic surface: 204.885 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 4 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.