 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | Oc1ccc(cc1)CC(NC(OCc1ccccc1)=O)C(=O)NC(C(=O)[O-])C |
| InChI: | InChI=1/C20H22N2O6/c1-13(19(25)26)21-18(24)17(11-14-7-9-16(23)10-8-14)22-20(27)28-12-15-5-3-2-4-6-15/h2-10,13,17,23H,11-12H2,1H3,(H,21,24)(H,22,27)(H,25,26)/p-1/t13-,17-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=49.2541 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 385.396 g/mol | logS: -3.83132 | SlogP: 0.75067 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0761233 | Sterimol/B1: 2.68983 | Sterimol/B2: 3.54236 | Sterimol/B3: 3.79561 | |||
| Sterimol/B4: 10.2897 | Sterimol/L: 17.8662 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 660.086 | Positive charged surface: 374.46 | Negative charged surface: 285.625 | Volume: 360.5 | |||
| Hydrophobic surface: 431.823 | Hydrophilic surface: 228.263 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 3 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
