Type: Neutral
Formula: C19H29N3O4S
SMILES: |
S(CCC(NC(=O)C(NC(OCc1ccccc1)=O)CCCC)C(=O)N)C |
InChI: |
InChI=1/C19H29N3O4S/c1-3-4-10-16(18(24)21-15(17(20)23)11-12-27-2)22-19(25)26-13-14-8-6-5-7-9-14/h5-9,15-16H,3-4,10-13H2,1-2H3,(H2,20,23)(H,21,24)(H,22,25)/t15-,16+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 395.524 g/mol | logS: -4.81203 | SlogP: 2.4612 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0654572 | Sterimol/B1: 2.5036 | Sterimol/B2: 2.57047 | Sterimol/B3: 5.3849 |
Sterimol/B4: 10.9543 | Sterimol/L: 19.3561 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 734.422 | Positive charged surface: 464.399 | Negative charged surface: 270.023 | Volume: 386.125 |
Hydrophobic surface: 490.359 | Hydrophilic surface: 244.063 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |