Type: Neutral
Formula: C20H27ClN4O4
| SMILES: |
Clc1cc2cc([nH]c2cc1)C(=O)NNC(=O)CCC(=O)NCCCOCCCC |
| InChI: |
InChI=1/C20H27ClN4O4/c1-2-3-10-29-11-4-9-22-18(26)7-8-19(27)24-25-20(28)17-13-14-12-15(21)5-6-16(14)23-17/h5-6,12-13,23H,2-4,7-11H2,1H3,(H,22,26)(H,24,27)(H,25,28) |
MOE's Descriptors
| Physical Properties | | | |
| Molecular Weight: 422.913 g/mol | logS: -4.31763 | SlogP: 2.6855 | Reactive groups: 0 |
| | | | |
| Topological Properties | | | |
| Globularity: 0.00420785 | Sterimol/B1: 2.37565 | Sterimol/B2: 2.37605 | Sterimol/B3: 3.28138 |
| Sterimol/B4: 5.64578 | Sterimol/L: 29.9451 | | | |
| | | | |
| Surface and Volume Properties | | | |
| Accessible surface: 789.74 | Positive charged surface: 502.815 | Negative charged surface: 281.262 | Volume: 396.625 |
| Hydrophobic surface: 584.83 | Hydrophilic surface: 204.91 | | |
| | | | |
| Pharmacophoric Properties | | | |
| Hydrogen bond donors: 4 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
| Chiral centers: 0 | | | |
| | | | |
| Drug- and Lead-like Properties | | | |
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
| |
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |