Type: Neutral
Formula: C19H28N2O2S
SMILES: |
S1CC(N(C(=O)c2ccccc2C)C1C(C)C)C(=O)NC(CC)C |
InChI: |
InChI=1/C19H28N2O2S/c1-6-14(5)20-17(22)16-11-24-19(12(2)3)21(16)18(23)15-10-8-7-9-13(15)4/h7-10,12,14,16,19H,6,11H2,1-5H3,(H,20,22)/t14-,16-,19-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 348.511 g/mol | logS: -4.6799 | SlogP: 3.44942 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.103254 | Sterimol/B1: 4.05373 | Sterimol/B2: 4.14713 | Sterimol/B3: 4.63318 |
Sterimol/B4: 6.06022 | Sterimol/L: 15.3822 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 579.884 | Positive charged surface: 381.61 | Negative charged surface: 198.273 | Volume: 346.125 |
Hydrophobic surface: 451.76 | Hydrophilic surface: 128.124 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |