Type: Neutral
Formula: C10H14N2O7
SMILES: |
O1C(CO)C(O)C(O)C1N1C=C(OC)C(=O)NC1=O |
InChI: |
InChI=1/C10H14N2O7/c1-18-4-2-12(10(17)11-8(4)16)9-7(15)6(14)5(3-13)19-9/h2,5-7,9,13-15H,3H2,1H3,(H,11,16,17)/t5-,6+,7+,9-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 274.229 g/mol | logS: 0.04194 | SlogP: -2.535 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.114835 | Sterimol/B1: 2.38181 | Sterimol/B2: 3.08293 | Sterimol/B3: 3.71448 |
Sterimol/B4: 7.60063 | Sterimol/L: 12.2733 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 455.879 | Positive charged surface: 335.075 | Negative charged surface: 120.805 | Volume: 221.625 |
Hydrophobic surface: 204.645 | Hydrophilic surface: 251.234 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |