Type: Neutral
Formula: C6H14NO8P
SMILES: |
P(OCC(O)C(O)C(O)C(N)C=O)(O)(O)=O |
InChI: |
InChI=1/C6H14NO8P/c7-3(1-8)5(10)6(11)4(9)2-15-16(12,13)14/h1,3-6,9-11H,2,7H2,(H2,12,13,14)/t3-,4-,5-,6-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 259.151 g/mol | logS: 1.70813 | SlogP: -4.3656 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.08125 | Sterimol/B1: 2.98008 | Sterimol/B2: 3.34541 | Sterimol/B3: 3.58232 |
Sterimol/B4: 3.79205 | Sterimol/L: 14.7308 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 440.168 | Positive charged surface: 261.683 | Negative charged surface: 178.485 | Volume: 199.375 |
Hydrophobic surface: 79.6166 | Hydrophilic surface: 360.5514 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 7 | Hydrogen bond acceptors: 9 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules
|