Type: Neutral
Formula: C10H14N2O5S
SMILES: |
S=C1NC(=O)C(=CN1C1OC(CO)C(O)C1O)C |
InChI: |
InChI=1/C10H14N2O5S/c1-4-2-12(10(18)11-8(4)16)9-7(15)6(14)5(3-13)17-9/h2,5-7,9,13-15H,3H2,1H3,(H,11,16,18)/t5-,6+,7-,9-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 274.297 g/mol | logS: -1.3605 | SlogP: -1.9541 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0864725 | Sterimol/B1: 2.47548 | Sterimol/B2: 3.23422 | Sterimol/B3: 3.56305 |
Sterimol/B4: 7.70398 | Sterimol/L: 12.29 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 453.339 | Positive charged surface: 285.707 | Negative charged surface: 167.632 | Volume: 226.625 |
Hydrophobic surface: 196.454 | Hydrophilic surface: 256.885 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |