Type: Neutral
Formula: C17H23NO4
SMILES: |
O1C2C(CC(CC2)c2ccccc2)C(O)C(NC(=O)C)C1O |
InChI: |
InChI=1/C17H23NO4/c1-10(19)18-15-16(20)13-9-12(11-5-3-2-4-6-11)7-8-14(13)22-17(15)21/h2-6,12-17,20-21H,7-9H2,1H3,(H,18,19)/t12-,13-,14+,15+,16-,17+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 305.374 g/mol | logS: -2.38546 | SlogP: 1.1531 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.153204 | Sterimol/B1: 2.60673 | Sterimol/B2: 4.17508 | Sterimol/B3: 4.44051 |
Sterimol/B4: 7.0095 | Sterimol/L: 15.0131 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 533.24 | Positive charged surface: 366.676 | Negative charged surface: 166.564 | Volume: 293.625 |
Hydrophobic surface: 408.514 | Hydrophilic surface: 124.726 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 6 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |