Type: Neutral
Formula: C14H25NO9
SMILES: |
O1C(COC(=O)CNC(OC(C)(C)C)=O)C(O)C(O)C(O)C1OC |
InChI: |
InChI=1/C14H25NO9/c1-14(2,3)24-13(20)15-5-8(16)22-6-7-9(17)10(18)11(19)12(21-4)23-7/h7,9-12,17-19H,5-6H2,1-4H3,(H,15,20)/t7-,9-,10-,11-,12+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 351.352 g/mol | logS: -0.93696 | SlogP: -1.4917 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.0371868 | Sterimol/B1: 2.50062 | Sterimol/B2: 3.89138 | Sterimol/B3: 4.61295 |
Sterimol/B4: 5.73264 | Sterimol/L: 18.8436 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 618.811 | Positive charged surface: 472.37 | Negative charged surface: 146.441 | Volume: 313 |
Hydrophobic surface: 345.535 | Hydrophilic surface: 273.276 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |