Type: Neutral
Formula: C13H22N2O4
SMILES: |
O(CC(C)C)C1C=C(CC(N)C1NC(=O)C)C(O)=O |
InChI: |
InChI=1/C13H22N2O4/c1-7(2)6-19-11-5-9(13(17)18)4-10(14)12(11)15-8(3)16/h5,7,10-12H,4,6,14H2,1-3H3,(H,15,16)(H,17,18)/t10-,11+,12+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 270.329 g/mol | logS: -0.87723 | SlogP: 0.2743 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0730442 | Sterimol/B1: 2.5235 | Sterimol/B2: 3.65243 | Sterimol/B3: 5.42556 |
Sterimol/B4: 5.99813 | Sterimol/L: 12.9677 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 500.796 | Positive charged surface: 347.64 | Negative charged surface: 153.156 | Volume: 264.375 |
Hydrophobic surface: 276.568 | Hydrophilic surface: 224.228 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |