 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1CCCC1CNC(=O)C1c2c(cccc2)C(=O)N(C)C1c1c2c(n(c1)C)cccc2 |
| InChI: | InChI=1/C25H27N3O3/c1-27-15-20(17-9-5-6-12-21(17)27)23-22(24(29)26-14-16-8-7-13-31-16)18-10-3-4-11-19(18)25(30)28(23)2/h3-6,9-12,15-16,22-23H,7-8,13-14H2,1-2H3,(H,26,29)/t16-,22+,23+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=105.454 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 417.509 g/mol | logS: -4.30285 | SlogP: 3.8387 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.206875 | Sterimol/B1: 3.82642 | Sterimol/B2: 3.89093 | Sterimol/B3: 6.78501 | |||
| Sterimol/B4: 8.00699 | Sterimol/L: 15.196 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 663.471 | Positive charged surface: 475.406 | Negative charged surface: 185.867 | Volume: 406.875 | |||
| Hydrophobic surface: 600.157 | Hydrophilic surface: 63.314 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.