Type: Neutral
Formula: C17H23N3O6
SMILES: |
O=C1NC(=O)NC(N(CC(O)C(O)C(O)CO)c2cc(C)c(cc2)C)=C1 |
InChI: |
InChI=1/C17H23N3O6/c1-9-3-4-11(5-10(9)2)20(7-12(22)16(25)13(23)8-21)14-6-15(24)19-17(26)18-14/h3-6,12-13,16,21-23,25H,7-8H2,1-2H3,(H2,18,19,24,26)/t12-,13+,16-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 365.386 g/mol | logS: -2.62724 | SlogP: -1.13436 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0973599 | Sterimol/B1: 2.45247 | Sterimol/B2: 3.77586 | Sterimol/B3: 4.18185 |
Sterimol/B4: 10.1415 | Sterimol/L: 15.6981 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 605.967 | Positive charged surface: 380.447 | Negative charged surface: 225.52 | Volume: 332 |
Hydrophobic surface: 313.882 | Hydrophilic surface: 292.085 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 6 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |