Type: Neutral
Formula: C6H15N2O7P
SMILES: |
P(OC1C(N)C(O)C(N)C(O)C1O)(O)(O)=O |
InChI: |
InChI=1/C6H15N2O7P/c7-1-3(9)2(8)6(5(11)4(1)10)15-16(12,13)14/h1-6,9-11H,7-8H2,(H2,12,13,14)/t1-,2+,3-,4+,5-,6-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 258.167 g/mol | logS: 1.90048 | SlogP: -4.855 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0823505 | Sterimol/B1: 2.83351 | Sterimol/B2: 3.20246 | Sterimol/B3: 4.53054 |
Sterimol/B4: 4.71543 | Sterimol/L: 12.32 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 410.157 | Positive charged surface: 273.042 | Negative charged surface: 137.115 | Volume: 197.625 |
Hydrophobic surface: 75.7135 | Hydrophilic surface: 334.4435 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 8 | Hydrogen bond acceptors: 9 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 6 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |