 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | P(OCC1OC(n2c3c(nc2)cc(cc3)C)C([O-])C1O)(=O)([O-])[O-] |
| InChI: | InChI=1/C13H16N2O7P/c1-7-2-3-9-8(4-7)14-6-15(9)13-12(17)11(16)10(22-13)5-21-23(18,19)20/h2-4,6,10-13,16H,5H2,1H3,(H2,18,19,20)/q-1/p-2/t10-,11+,12+,13+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=57.6902 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 341.236 g/mol | logS: -1.73924 | SlogP: -1.72728 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0425393 | Sterimol/B1: 3.04359 | Sterimol/B2: 3.67036 | Sterimol/B3: 4.45929 | |||
| Sterimol/B4: 4.8429 | Sterimol/L: 17.0345 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 535.113 | Positive charged surface: 261.215 | Negative charged surface: 273.898 | Volume: 276 | |||
| Hydrophobic surface: 307.836 | Hydrophilic surface: 227.277 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 4 | Acid groups: 4 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
