 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1C(CO)C(O)C([O-])C1[N+]1=C[NH2+][C-](C(=O)N)C1[O-] |
| InChI: | InChI=1/C9H14N3O6/c10-7(16)4-8(17)12(2-11-4)9-6(15)5(14)3(1-13)18-9/h2-3,5-6,8-9,13-14H,1,11H2,(H2,10,16)/q-1/t3-,5+,6-,8-,9-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=-7.35925 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 260.226 g/mol | logS: 0.60585 | SlogP: -4.74471 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.11611 | Sterimol/B1: 3.14343 | Sterimol/B2: 3.61574 | Sterimol/B3: 3.91095 | |||
| Sterimol/B4: 6.27258 | Sterimol/L: 12.17 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 432.071 | Positive charged surface: 280.351 | Negative charged surface: 151.72 | Volume: 213.875 | |||
| Hydrophobic surface: 122.999 | Hydrophilic surface: 309.072 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 4 | Hydrogen bond acceptors: 4 | Acid groups: 2 | Basic groups: 1 | |||
| Chiral centers: 6 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | ||||
|
