 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | Oc1cc(ccc1)C([NH+]1CC([NH+](CC1C)CC=C)C)c1ccc(cc1)C(=O)N(CC) CC |
| InChI: | InChI=1/C27H37N3O2/c1-6-16-29-18-21(5)30(19-20(29)4)26(24-10-9-11-25(31)17-24)22-12-14-23(15-13-22)27(32)28(7-2)8-3/h6,9-15,17,20-21,26,31H,1,7-8,16,18-19H2,2-5H3/p+2/t20-,21-,26+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=133.576 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 437.628 g/mol | logS: -4.50544 | SlogP: 1.8055 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.123961 | Sterimol/B1: 4.05838 | Sterimol/B2: 5.04537 | Sterimol/B3: 6.23972 | |||
| Sterimol/B4: 8.08466 | Sterimol/L: 18.3074 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 762.778 | Positive charged surface: 520.215 | Negative charged surface: 242.563 | Volume: 477.25 | |||
| Hydrophobic surface: 552.279 | Hydrophilic surface: 210.499 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 2 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
