 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S(C(=O)C)CC(C(=O)N1CCCC1C(=O)NC(Cc1ccccc1)C(=O)[O-])C |
| InChI: | InChI=1/C20H26N2O5S/c1-13(12-28-14(2)23)19(25)22-10-6-9-17(22)18(24)21-16(20(26)27)11-15-7-4-3-5-8-15/h3-5,7-8,13,16-17H,6,9-12H2,1-2H3,(H,21,24)(H,26,27)/p-1/t13-,16+,17-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=71.4794 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 405.495 g/mol | logS: -3.93797 | SlogP: 0.37057 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.147393 | Sterimol/B1: 3.49058 | Sterimol/B2: 4.0615 | Sterimol/B3: 6.12631 | |||
| Sterimol/B4: 8.41868 | Sterimol/L: 16.7344 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 675.601 | Positive charged surface: 402.056 | Negative charged surface: 273.544 | Volume: 382.5 | |||
| Hydrophobic surface: 469.883 | Hydrophilic surface: 205.718 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 3 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
