Type: Neutral
Formula: C15H24N2O6
SMILES: |
O1C(CO)(C)C(O)(C)C(C)(C)C1(N1C=C(CO)C(=O)NC1=O)C |
InChI: |
InChI=1/C15H24N2O6/c1-12(2)14(4,22)13(3,8-19)23-15(12,5)17-6-9(7-18)10(20)16-11(17)21/h6,18-19,22H,7-8H2,1-5H3,(H,16,20,21)/t13-,14-,15+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 328.365 g/mol | logS: -1.64341 | SlogP: -0.311 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.286559 | Sterimol/B1: 2.12482 | Sterimol/B2: 4.17071 | Sterimol/B3: 4.79111 |
Sterimol/B4: 7.60456 | Sterimol/L: 12.4836 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 485.998 | Positive charged surface: 337.995 | Negative charged surface: 148.002 | Volume: 289.25 |
Hydrophobic surface: 211.129 | Hydrophilic surface: 274.869 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |