 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1CCCC(=O)NC(CC(=O)N)C(=O)NC(Cc2ccc1cc2)C(O)C[NH2+]CCC(C)C |
| InChI: | InChI=1/C23H36N4O5/c1-15(2)9-10-25-14-20(28)18-12-16-5-7-17(8-6-16)32-11-3-4-22(30)26-19(13-21(24)29)23(31)27-18/h5-8,15,18-20,25,28H,3-4,9-14H2,1-2H3,(H2,24,29)(H,26,30)(H,27,31)/p+1/t18-,19-,20-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=51.1304 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 449.572 g/mol | logS: -3.30787 | SlogP: -0.78293 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.161767 | Sterimol/B1: 4.16886 | Sterimol/B2: 4.88557 | Sterimol/B3: 5.20359 | |||
| Sterimol/B4: 6.26728 | Sterimol/L: 16.6771 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 673.793 | Positive charged surface: 496.352 | Negative charged surface: 177.441 | Volume: 445.625 | |||
| Hydrophobic surface: 467.856 | Hydrophilic surface: 205.937 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 4 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | ||||
|
