Type: Neutral
Formula: C14H21N5O4
SMILES: |
O1C(n2c3ncnc(N)c3nc2)(C)C(OC)(C)C(O)(C)C1CO |
InChI: |
InChI=1/C14H21N5O4/c1-12(21)8(5-20)23-14(3,13(12,2)22-4)19-7-18-9-10(15)16-6-17-11(9)19/h6-8,20-21H,5H2,1-4H3,(H2,15,16,17)/t8-,12+,13+,14-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 323.353 g/mol | logS: -2.46472 | SlogP: -0.0601 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.203981 | Sterimol/B1: 3.11773 | Sterimol/B2: 3.55172 | Sterimol/B3: 4.77844 |
Sterimol/B4: 6.23784 | Sterimol/L: 13.506 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 507.246 | Positive charged surface: 392.562 | Negative charged surface: 114.684 | Volume: 289.75 |
Hydrophobic surface: 240.235 | Hydrophilic surface: 267.011 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |